CAS 7421-93-4 appears in our catalog under these names: Endrin-aldehyde, Endrin-aldehyde 100 µg/mL in Acetonitrile, Endrin aldehyde Standard, Endrin aldehyde, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, GLPBio, HPC Standards. Available pack sizes: 10mg, 5ml, 1ml, 1x5ml.
3,4,5,6,6,7-hexachloropentacyclo[6.3.0.02,4.03,7.05,9]undecane-10-carbaldehyde (CAS 7421-93-4) is a chemical compound with the molecular formula C12H8Cl6O and a molecular weight of 380.9 g/mol. IUPAC name: 3,4,5,6,6,7-hexachloropentacyclo[6.3.0.02,4.03,7.05,9]undecane-10-carbaldehyde. InChIKey: HCTWZIFNBBCVGM-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl6O |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | 3,4,5,6,6,7-hexachloropentacyclo[6.3.0.02,4.03,7.05,9]undecane-10-carbaldehyde |
| InChIKey | HCTWZIFNBBCVGM-UHFFFAOYSA-N |
| SMILES | C1C(C2C3C1C4C5(C2(C(C3(C45Cl)Cl)(Cl)Cl)Cl)Cl)C=O |
Computed by PubChem (NCBI)