CAS 91406-11-0 appears in our catalog under these names: Esuprone/ 99.66% (existing batch purity), Esuprone, Esuprone, 99.55%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
(3,4-dimethyl-2-oxochromen-7-yl) ethanesulfonate (CAS 91406-11-0) is a chemical compound with the molecular formula C13H14O5S and a molecular weight of 282.31 g/mol. IUPAC name: (3,4-dimethyl-2-oxochromen-7-yl) ethanesulfonate. InChIKey: CHDGAVDQRSPBTA-UHFFFAOYSA-N.
| Molecular formula | C13H14O5S |
|---|---|
| Molecular weight | 282.31 g/mol |
| IUPAC name | (3,4-dimethyl-2-oxochromen-7-yl) ethanesulfonate |
| InChIKey | CHDGAVDQRSPBTA-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)OC1=CC2=C(C=C1)C(=C(C(=O)O2)C)C |
Computed by PubChem (NCBI)