cas: 937059-62-6 — see every product listed under this CAS number, including other names
Ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, 98% (CAS 937059-62-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 25mg, 50mg. Offered by: AmBeed, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A572581-5g |
| cas | 937059-62-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17979.01 Pln | |
| AmBeed | 10g | 28297.36 Pln | |
| Ambeed | 100mg | 1243.69 Pln | |
| Ambeed | 250mg | 2061.38 Pln | |
| Ambeed | 1g | 5448.94 Pln | |
| Chemat | 25mg | 496.40 Pln | |
| Chemat | 50mg | 789.20 Pln | |
| Chemat | 100mg | 1298.00 Pln | |
| Chemat | 250mg | 2435.60 Pln | |
| Chemat | 1g | 5790.80 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Cis-ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 937059-62-6) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: cis-ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: MLDUTPQKFFVCJJ-KZYPOYLOSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | cis-ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | MLDUTPQKFFVCJJ-KZYPOYLOSA-N |
| SMILES | CCOC(=O)[C@H]1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)