Products 874365-37-4

CAS 874365-37-4 is the registry number for Methyl 3-(3-piperidinyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g, 25g.

Structural formula: {0} (CAS {1})

Methyl 3-piperidin-3-ylpropanoate;hydrochloride (CAS 874365-37-4) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: methyl 3-piperidin-3-ylpropanoate;hydrochloride. InChIKey: VGGGAKLPBUNWKF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC namemethyl 3-piperidin-3-ylpropanoate;hydrochloride
InChIKeyVGGGAKLPBUNWKF-UHFFFAOYSA-N
SMILESCOC(=O)CCC1CCCNC1.Cl

Computed by PubChem (NCBI)