CAS 1898181-18-4 appears in our catalog under these names: (1R,3S)-Ethyl 3-aminocyclohexanecarboxylate hydrochloride, 95%, Ethyl (1R,3S)-3-aminocyclohexane-1-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
Cis-ethyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 1898181-18-4) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: cis-ethyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: MLDUTPQKFFVCJJ-WLYNEOFISA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | cis-ethyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | MLDUTPQKFFVCJJ-WLYNEOFISA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)