Ethyl (4-nitrophenyl) carbonate, 98%
cas: 6132-45-2 — see every product listed under this CAS number, including other names
Ethyl (4-nitrophenyl) carbonate, 98% (CAS 6132-45-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1424392-100mg |
| cas | 6132-45-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 904.38 Pln | |
| Ambeed | 250mg | 1749.88 Pln | |
| Ambeed | 1g | 4586.75 Pln | |
| BLDpharm | 50mg | 608.70 Pln | |
| BLDpharm | 100mg | 969.68 Pln | |
| BLDpharm | 250mg | 1880.47 Pln | |
| BLDpharm | 1g | 4940.51 Pln | |
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1408.40 Pln | |
| Chemat | 1g | 3693.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl (4-nitrophenyl) carbonate (CAS 6132-45-2) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: ethyl (4-nitrophenyl) carbonate. InChIKey: OFJLSOXXIMLDDL-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | ethyl (4-nitrophenyl) carbonate |
| InChIKey | OFJLSOXXIMLDDL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
