cas: 55919-47-6 — see every product listed under this CAS number, including other names
Ethyl α-bromo-β-oxobenzenepropanoate, 90%, 90% (CAS 55919-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBC6-100mg |
| cas | 55919-47-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 587.60 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-bromo-3-oxo-3-phenylpropanoate (CAS 55919-47-6) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: ethyl 2-bromo-3-oxo-3-phenylpropanoate. InChIKey: LYOCLQBWSNCBBN-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | ethyl 2-bromo-3-oxo-3-phenylpropanoate |
| InChIKey | LYOCLQBWSNCBBN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C1=CC=CC=C1)Br |
Computed by PubChem (NCBI)