cas: 39513-47-8 — see every product listed under this CAS number, including other names
Ethyl 1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate, 95%, 95% (CAS 39513-47-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BEIL-250mg |
| cas | 39513-47-8 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 760.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate (CAS 39513-47-8) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate. InChIKey: NBPWUCASXSGJQX-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate |
| InChIKey | NBPWUCASXSGJQX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C(=O)N(C1=O)C)C |
Computed by PubChem (NCBI)