Ethyl 1-(2-bromophenyl)-5-fluoro-1H-pyrazole-4-carboxylate, 95+%
cas: 1269294-11-2 — see every product listed under this CAS number, including other names
Ethyl 1-(2-bromophenyl)-5-fluoro-1H-pyrazole-4-carboxylate, 95+% (CAS 1269294-11-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A662696-25mg |
| cas | 1269294-11-2 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 414.88 Pln | |
| Ambeed | 50mg | 654.06 Pln | |
| Ambeed | 100mg | 1049.00 Pln | |
| Chemat | 25mg | 462.80 Pln | |
| Chemat | 50mg | 746.00 Pln | |
| Chemat | 100mg | 1221.20 Pln | |
| Chemat | 250mg | 2147.60 Pln | |
| Chemat | 1g | 5685.20 Pln | |
| BLDpharm | 25mg | 442.09 Pln | |
| BLDpharm | 50mg | 697.56 Pln | |
| BLDpharm | 100mg | 1125.18 Pln | |
| BLDpharm | 250mg | 1963.78 Pln | |
| BLDpharm | 1g | 5179.31 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 1-(2-bromophenyl)-5-fluoropyrazole-4-carboxylate (CAS 1269294-11-2) is a chemical compound with the molecular formula C12H10BrFN2O2 and a molecular weight of 313.12 g/mol. IUPAC name: ethyl 1-(2-bromophenyl)-5-fluoropyrazole-4-carboxylate. InChIKey: CTJKROFUCSGPOM-UHFFFAOYSA-N.
| Molecular formula | C12H10BrFN2O2 |
|---|---|
| Molecular weight | 313.12 g/mol |
| IUPAC name | ethyl 1-(2-bromophenyl)-5-fluoropyrazole-4-carboxylate |
| InChIKey | CTJKROFUCSGPOM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC=CC=C2Br)F |
Computed by PubChem (NCBI)