CAS 854023-65-7 is the registry number for N-(4-Bromo-2-fluorophenyl)-3,5-dimethylisoxazole-4-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-bromo-2-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (CAS 854023-65-7) is a chemical compound with the molecular formula C12H10BrFN2O2 and a molecular weight of 313.12 g/mol. IUPAC name: N-(4-bromo-2-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide. InChIKey: FYSNKZQQVHGQBP-UHFFFAOYSA-N.
| Molecular formula | C12H10BrFN2O2 |
|---|---|
| Molecular weight | 313.12 g/mol |
| IUPAC name | N-(4-bromo-2-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| InChIKey | FYSNKZQQVHGQBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C(=O)NC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)