Products 1306228-97-6
CAS 1306228-97-6 is the registry number for N-(5-Bromo-2-fluorobenzyl)-3-methylisoxazole-5-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5-bromo-2-fluorophenyl)methyl]-3-methyl-1,2-oxazole-5-carboxamide (CAS 1306228-97-6) is a chemical compound with the molecular formula C12H10BrFN2O2 and a molecular weight of 313.12 g/mol. IUPAC name: N-[(5-bromo-2-fluorophenyl)methyl]-3-methyl-1,2-oxazole-5-carboxamide. InChIKey: UFEITXCKEZDSHX-UHFFFAOYSA-N.
| Molecular formula | C12H10BrFN2O2 |
|---|---|
| Molecular weight | 313.12 g/mol |
| IUPAC name | N-[(5-bromo-2-fluorophenyl)methyl]-3-methyl-1,2-oxazole-5-carboxamide |
| InChIKey | UFEITXCKEZDSHX-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C(=O)NCC2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)