cas: 1313498-26-8 — see every product listed under this CAS number, including other names
Ethyl 1-Boc-2-oxopiperidine-4-carboxylate, ≥97%, ≥97% (CAS 1313498-26-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DEJR-100mg |
| cas | 1313498-26-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2886.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 4-O-ethyl 2-oxopiperidine-1,4-dicarboxylate (CAS 1313498-26-8) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 2-oxopiperidine-1,4-dicarboxylate. InChIKey: VLECXBXMFQBFQS-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 2-oxopiperidine-1,4-dicarboxylate |
| InChIKey | VLECXBXMFQBFQS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(C(=O)C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)