cas: 98977-34-5 — see every product listed under this CAS number, including other names
Ethyl 1-tert-Butoxycarbonyl-4-oxo-3-piperidinecarboxylate 97% (CAS 98977-34-5) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A149124-1000g |
| cas | 98977-34-5 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4280.81 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 604.00 Pln | |
| Ambeed | 500g | 2701.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A149124 |
1-O-tert-butyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate (CAS 98977-34-5) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate. InChIKey: ABBVAMUCDQETDO-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate |
| InChIKey | ABBVAMUCDQETDO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CCC1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)