CAS 1754-55-8 appears in our catalog under these names: Ethyl 2,4,6-trimethylbenzoate, 95%, Ethyl 2,4,6–Trimethylbenzoate, Ethyl 2,4,6-Trimethylbenzoate, >95.0%(GC), Benzoic acid, 2,4,6-trimethyl-, ethyl ester, 97%, 97%, Ethyl 2,4,6-trimethylbenzoate, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 500g.
Ethyl 2,4,6-trimethylbenzoate (CAS 1754-55-8) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: ethyl 2,4,6-trimethylbenzoate. InChIKey: ZXTXIZPSMQCYBN-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | ethyl 2,4,6-trimethylbenzoate |
| InChIKey | ZXTXIZPSMQCYBN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1C)C)C |
Computed by PubChem (NCBI)