cas: 51079-10-8 — see every product listed under this CAS number, including other names
Ethyl 2-(1H-indol-3-yl)-2-oxoacetate, 98%, 98% (CAS 51079-10-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9IC-250mg |
| cas | 51079-10-8 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 10g | 669.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(1H-indol-3-yl)-2-oxoacetate (CAS 51079-10-8) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: ethyl 2-(1H-indol-3-yl)-2-oxoacetate. InChIKey: WTPMFFQBDYIARF-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | ethyl 2-(1H-indol-3-yl)-2-oxoacetate |
| InChIKey | WTPMFFQBDYIARF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)