cas: 51079-10-8 — see every product listed under this CAS number, including other names
Ethyl 2-(indol-3-yl)-2-oxoacetate, 96% (CAS 51079-10-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050047-1G |
| cas | 51079-10-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 440.49 Pln | |
| Fluorochem | 10g | 825.77 Pln | |
| Fluorochem | 25g | 1976.41 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(1H-indol-3-yl)-2-oxoacetate (CAS 51079-10-8) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: ethyl 2-(1H-indol-3-yl)-2-oxoacetate. InChIKey: WTPMFFQBDYIARF-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | ethyl 2-(1H-indol-3-yl)-2-oxoacetate |
| InChIKey | WTPMFFQBDYIARF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)