cas: 1351500-37-2 — see every product listed under this CAS number, including other names
Ethyl 2-(2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetate, 98% (CAS 1351500-37-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A827904-100mg |
| cas | 1351500-37-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1577.44 Pln | |
| Ambeed | 25g | 5938.44 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 2426.00 Pln | |
| Chemat | 25g | 4840.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 1351500-37-2) is a chemical compound with the molecular formula C16H22BFO4 and a molecular weight of 308.2 g/mol. IUPAC name: ethyl 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: IDLKSCIRMPIZOL-UHFFFAOYSA-N.
| Molecular formula | C16H22BFO4 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | ethyl 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | IDLKSCIRMPIZOL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CC(=O)OCC)F |
Computed by PubChem (NCBI)