CAS 1198615-89-2 is the registry number for Ethyl 2-(2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 1198615-89-2) is a chemical compound with the molecular formula C16H22BFO4 and a molecular weight of 308.2 g/mol. IUPAC name: ethyl 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: AZRMRGFTXPQBLK-UHFFFAOYSA-N.
| Molecular formula | C16H22BFO4 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | ethyl 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | AZRMRGFTXPQBLK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)CC(=O)OCC |
Computed by PubChem (NCBI)