CAS 3031106-68-7 appears in our catalog under these names: Benzeneacetic acid, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester, 97%, 97%, Benzeneacetic acid, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Ethyl 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 3031106-68-7) is a chemical compound with the molecular formula C16H22BFO4 and a molecular weight of 308.2 g/mol. IUPAC name: ethyl 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: SHNGRCMCKMMUHQ-UHFFFAOYSA-N.
| Molecular formula | C16H22BFO4 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | ethyl 2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | SHNGRCMCKMMUHQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CC(=O)OCC)F |
Computed by PubChem (NCBI)