Ethyl 2-(3-amino-2-methylphenyl)acetate, 95%
cas: 812668-49-8 — see every product listed under this CAS number, including other names
Ethyl 2-(3-amino-2-methylphenyl)acetate, 95% (CAS 812668-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1618052-100mg |
| cas | 812668-49-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 3274.00 Pln | |
| BLDpharm | 100mg | 519.84 Pln | |
| BLDpharm | 250mg | 1119.63 Pln | |
| BLDpharm | 1g | 3207.78 Pln | |
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 1058.00 Pln | |
| Chemat | 1g | 3054.80 Pln | |
| Fluorochem | 100mg | 903.87 Pln | |
| Fluorochem | 250mg | 1955.58 Pln | |
| Fluorochem | 1g | 5667.81 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-(3-amino-2-methylphenyl)acetate (CAS 812668-49-8) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: ethyl 2-(3-amino-2-methylphenyl)acetate. InChIKey: HVOZUIWWSPZBMH-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | ethyl 2-(3-amino-2-methylphenyl)acetate |
| InChIKey | HVOZUIWWSPZBMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C(=CC=C1)N)C |
Computed by PubChem (NCBI)