cas: 160844-75-7 — see every product listed under this CAS number, including other names
Ethyl 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-5-thiazolecarboxylate 97% (CAS 160844-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311178-250mg |
| cas | 160844-75-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 398.19 Pln | |
| Ambeed | 25g | 854.31 Pln | |
| Ambeed | 100g | 3207.25 Pln | |
| Ambeed | 500g | 13208.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A311178 |
Ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (CAS 160844-75-7) is a chemical compound with the molecular formula C18H20N2O3S and a molecular weight of 344.4 g/mol. IUPAC name: ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: OGAZOYHQFBSRMC-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | OGAZOYHQFBSRMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=CC(=C(C=C2)OCC(C)C)C#N)C |
Computed by PubChem (NCBI)