cas: 160844-75-7 — see every product listed under this CAS number, including other names
Ethyl 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-5-thiazolecarboxylate, 97%, 97% (CAS 160844-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VEX-250mg |
| cas | 160844-75-7 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 342.80 Pln | |
| Chemat | 25g | 654.80 Pln | |
| Chemat | 100g | 2032.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (CAS 160844-75-7) is a chemical compound with the molecular formula C18H20N2O3S and a molecular weight of 344.4 g/mol. IUPAC name: ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: OGAZOYHQFBSRMC-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | OGAZOYHQFBSRMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=CC(=C(C=C2)OCC(C)C)C#N)C |
Computed by PubChem (NCBI)