cas: 160844-75-7 — see every product listed under this CAS number, including other names
Ethyl 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-5-thiazolecarboxylate (CAS 160844-75-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 25g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FE45493-5g |
| cas | 160844-75-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 539.41 Pln | |
| Fluorochem | 25g | 1158.98 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Sourcing |
| purity | No data |
| delivery time | 3-4 weeks |
Ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (CAS 160844-75-7) is a chemical compound with the molecular formula C18H20N2O3S and a molecular weight of 344.4 g/mol. IUPAC name: ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: OGAZOYHQFBSRMC-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | ethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | OGAZOYHQFBSRMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=CC(=C(C=C2)OCC(C)C)C#N)C |
Computed by PubChem (NCBI)