cas: 147283-76-9 — see every product listed under this CAS number, including other names
Ethyl 2-(3-nitro-2-oxopyridin-1(2H)-yl)acetate, 95-<97% (CAS 147283-76-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC2025-95-97-5g |
| cas | 147283-76-9 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 5437.52 Pln | |
| Hoffman Fine Chemicals | 10g | 8519.06 Pln | |
| Hoffman Fine Chemicals | 25g | 16730.12 Pln | |
| Hoffman Fine Chemicals | 50g | 26580.84 Pln | |
| Hoffman Fine Chemicals | 100g | 44974.38 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Ethyl 2-(3-nitro-2-oxo-1-pyridinyl)acetate (CAS 147283-76-9) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: ethyl 2-(3-nitro-2-oxo-1-pyridinyl)acetate. InChIKey: YUAVHQCGIUMCPH-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | ethyl 2-(3-nitro-2-oxo-1-pyridinyl)acetate |
| InChIKey | YUAVHQCGIUMCPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=CC=C(C1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)