CAS 367454-82-8 is the registry number for (4,6-Dimethyl-3-nitro-2-oxopyridin-1(2h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4,6-dimethyl-3-nitro-2-oxo-1-pyridinyl)acetic acid (CAS 367454-82-8) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: 2-(4,6-dimethyl-3-nitro-2-oxo-1-pyridinyl)acetic acid. InChIKey: DHPOXPMQHNJROT-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 2-(4,6-dimethyl-3-nitro-2-oxo-1-pyridinyl)acetic acid |
| InChIKey | DHPOXPMQHNJROT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1CC(=O)O)[N+](=O)[O-])C |
Computed by PubChem (NCBI)