Products 367454-82-8

CAS 367454-82-8 is the registry number for (4,6-Dimethyl-3-nitro-2-oxopyridin-1(2h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4,6-dimethyl-3-nitro-2-oxo-1-pyridinyl)acetic acid (CAS 367454-82-8) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: 2-(4,6-dimethyl-3-nitro-2-oxo-1-pyridinyl)acetic acid. InChIKey: DHPOXPMQHNJROT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N2O5
Molecular weight226.19 g/mol
IUPAC name2-(4,6-dimethyl-3-nitro-2-oxo-1-pyridinyl)acetic acid
InChIKeyDHPOXPMQHNJROT-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=O)N1CC(=O)O)[N+](=O)[O-])C

Computed by PubChem (NCBI)