CAS 75082-88-1 is the registry number for Beta-hydroxy-3-nitrophenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2S)-2-amino-3-hydroxy-3-(3-nitrophenyl)propanoic acid (CAS 75082-88-1) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: (2S)-2-amino-3-hydroxy-3-(3-nitrophenyl)propanoic acid. InChIKey: MBHARJQAJLMPIU-JAMMHHFISA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | (2S)-2-amino-3-hydroxy-3-(3-nitrophenyl)propanoic acid |
| InChIKey | MBHARJQAJLMPIU-JAMMHHFISA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C([C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)