cas: 864754-16-5 — see every product listed under this CAS number, including other names
Ethyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetate 97% (CAS 864754-16-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181194-250mg |
| cas | 864754-16-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 10g | 726.38 Pln | |
| Ambeed | 25g | 1616.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A181194 |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate (CAS 864754-16-5) is a chemical compound with the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate. InChIKey: YUEZJHOSHBTWPV-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O4 |
|---|---|
| Molecular weight | 280.13 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate |
| InChIKey | YUEZJHOSHBTWPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(=O)OCC |
Computed by PubChem (NCBI)