cas: 864754-16-5 — see every product listed under this CAS number, including other names
Ethyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetate, 98%, 98% (CAS 864754-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147CO-100mg |
| cas | 864754-16-5 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 818.00 Pln | |
| Chemat | 100g | 2334.80 Pln | |
| Chemat | 1kg | 9770.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate (CAS 864754-16-5) is a chemical compound with the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate. InChIKey: YUEZJHOSHBTWPV-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O4 |
|---|---|
| Molecular weight | 280.13 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate |
| InChIKey | YUEZJHOSHBTWPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(=O)OCC |
Computed by PubChem (NCBI)