cas: 209667-59-4 — see every product listed under this CAS number, including other names
Ethyl 2-(4-Boc-1-piperazinyl)acetate, 98%, 98% (CAS 209667-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113KCT-100mg |
| cas | 209667-59-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 10g | 1571.60 Pln | |
| Chemat | 25g | 2882.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate (CAS 209667-59-4) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate. InChIKey: BWRNREIEPIQCOI-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate |
| InChIKey | BWRNREIEPIQCOI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)