cas: 209667-59-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate, 98% (CAS 209667-59-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092457-1G |
| cas | 209667-59-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 518.59 Pln | |
| Fluorochem | 10g | 971.55 Pln | |
| Fluorochem | 25g | 1658.81 Pln | |
| Fluorochem | 100g | 4475.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate (CAS 209667-59-4) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate. InChIKey: BWRNREIEPIQCOI-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate |
| InChIKey | BWRNREIEPIQCOI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)