cas: 130754-19-7 — see every product listed under this CAS number, including other names
Ethyl 2-(4-Chlorophenyl)-2,2-difluoroacetate 95% (CAS 130754-19-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A263653-1g |
| cas | 130754-19-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 581.75 Pln | |
| Ambeed | 10g | 948.88 Pln | |
| Ambeed | 25g | 1827.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A263653 |
Ethyl 2-(4-chlorophenyl)-2,2-difluoroacetate (CAS 130754-19-7) is a chemical compound with the molecular formula C10H9ClF2O2 and a molecular weight of 234.62 g/mol. IUPAC name: ethyl 2-(4-chlorophenyl)-2,2-difluoroacetate. InChIKey: VGULHXRXMXNYHN-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O2 |
|---|---|
| Molecular weight | 234.62 g/mol |
| IUPAC name | ethyl 2-(4-chlorophenyl)-2,2-difluoroacetate |
| InChIKey | VGULHXRXMXNYHN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)Cl)(F)F |
Computed by PubChem (NCBI)