cas: 130754-19-7 — see every product listed under this CAS number, including other names
Ethyl-2,2-difluoro-2-(4-chlorophenyl)acetate, 95% (CAS 130754-19-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036003-250MG |
| cas | 130754-19-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 456.11 Pln | |
| Fluorochem | 10g | 726.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(4-chlorophenyl)-2,2-difluoroacetate (CAS 130754-19-7) is a chemical compound with the molecular formula C10H9ClF2O2 and a molecular weight of 234.62 g/mol. IUPAC name: ethyl 2-(4-chlorophenyl)-2,2-difluoroacetate. InChIKey: VGULHXRXMXNYHN-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O2 |
|---|---|
| Molecular weight | 234.62 g/mol |
| IUPAC name | ethyl 2-(4-chlorophenyl)-2,2-difluoroacetate |
| InChIKey | VGULHXRXMXNYHN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)Cl)(F)F |
Computed by PubChem (NCBI)