Products 2848722-29-0

CAS 2848722-29-0 is the registry number for 2-(3-Chloro-4-(1,1-difluoroethyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[3-chloro-4-(1,1-difluoroethyl)phenyl]acetic acid (CAS 2848722-29-0) is a chemical compound with the molecular formula C10H9ClF2O2 and a molecular weight of 234.62 g/mol. IUPAC name: 2-[3-chloro-4-(1,1-difluoroethyl)phenyl]acetic acid. InChIKey: UIUXXGFZADVKDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClF2O2
Molecular weight234.62 g/mol
IUPAC name2-[3-chloro-4-(1,1-difluoroethyl)phenyl]acetic acid
InChIKeyUIUXXGFZADVKDQ-UHFFFAOYSA-N
SMILESCC(C1=C(C=C(C=C1)CC(=O)O)Cl)(F)F

Computed by PubChem (NCBI)