CAS 2848722-29-0 is the registry number for 2-(3-Chloro-4-(1,1-difluoroethyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-chloro-4-(1,1-difluoroethyl)phenyl]acetic acid (CAS 2848722-29-0) is a chemical compound with the molecular formula C10H9ClF2O2 and a molecular weight of 234.62 g/mol. IUPAC name: 2-[3-chloro-4-(1,1-difluoroethyl)phenyl]acetic acid. InChIKey: UIUXXGFZADVKDQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O2 |
|---|---|
| Molecular weight | 234.62 g/mol |
| IUPAC name | 2-[3-chloro-4-(1,1-difluoroethyl)phenyl]acetic acid |
| InChIKey | UIUXXGFZADVKDQ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)CC(=O)O)Cl)(F)F |
Computed by PubChem (NCBI)