cas: 199328-35-3 — see every product listed under this CAS number, including other names
Ethyl 2-(4-bromo-2-nitrophenyl)acetate 98% (CAS 199328-35-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A238474-250mg |
| cas | 199328-35-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 437.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A238474 |
Ethyl 2-(4-bromo-2-nitrophenyl)acetate (CAS 199328-35-3) is a chemical compound with the molecular formula C10H10BrNO4 and a molecular weight of 288.09 g/mol. IUPAC name: ethyl 2-(4-bromo-2-nitrophenyl)acetate. InChIKey: VZLHDZQLBGMIGO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4 |
|---|---|
| Molecular weight | 288.09 g/mol |
| IUPAC name | ethyl 2-(4-bromo-2-nitrophenyl)acetate |
| InChIKey | VZLHDZQLBGMIGO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)