CAS 2409596-89-8 is the registry number for Methyl 2-(4-bromo-2-nitrophenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-(4-bromo-2-nitrophenyl)propanoate (CAS 2409596-89-8) is a chemical compound with the molecular formula C10H10BrNO4 and a molecular weight of 288.09 g/mol. IUPAC name: methyl 2-(4-bromo-2-nitrophenyl)propanoate. InChIKey: YZBOZPZKHWIGHH-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4 |
|---|---|
| Molecular weight | 288.09 g/mol |
| IUPAC name | methyl 2-(4-bromo-2-nitrophenyl)propanoate |
| InChIKey | YZBOZPZKHWIGHH-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Br)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)