Products 1805600-33-2
CAS 1805600-33-2 is the registry number for Ethyl 4-bromo-5-methyl-2-nitrobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Ethyl 4-bromo-5-methyl-2-nitrobenzoate (CAS 1805600-33-2) is a chemical compound with the molecular formula C10H10BrNO4 and a molecular weight of 288.09 g/mol. IUPAC name: ethyl 4-bromo-5-methyl-2-nitrobenzoate. InChIKey: BSMHJEAUFMZNQO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4 |
|---|---|
| Molecular weight | 288.09 g/mol |
| IUPAC name | ethyl 4-bromo-5-methyl-2-nitrobenzoate |
| InChIKey | BSMHJEAUFMZNQO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C(=C1)C)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)