cas: 132089-35-1 — see every product listed under this CAS number, including other names
Ethyl 2-(4-fluorophenyl)thiazole-4-carboxylate 96% (CAS 132089-35-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146547-250mg |
| cas | 132089-35-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A146547 |
Ethyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate (CAS 132089-35-1) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: ethyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: ZFFKADGHYYXMLY-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | ethyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | ZFFKADGHYYXMLY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)