CAS 886369-79-5 appears in our catalog under these names: 2-(3-Fluoro-phenyl)-thiazole-5-carboxylic acid ethyl ester, 97%, 2-(3-FLUORO-PHENYL)-THIAZOLE-5-CARBOXYLIC ACID ETHYL ESTER, 98%, 98%, ETHYL 2-(3-FLUOROPHENYL)THIAZOLE-5-CARBOXYLATE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 250mg, 100mg.
Ethyl 2-(3-fluorophenyl)-1,3-thiazole-5-carboxylate (CAS 886369-79-5) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: ethyl 2-(3-fluorophenyl)-1,3-thiazole-5-carboxylate. InChIKey: PIIGTUHXTVQOFW-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | ethyl 2-(3-fluorophenyl)-1,3-thiazole-5-carboxylate |
| InChIKey | PIIGTUHXTVQOFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(S1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)