Products 132089-37-3
CAS 132089-37-3 appears in our catalog under these names: Ethyl 2-(3-fluorophenyl)thiazole-4-carboxylate, 98%, 2-(3-Fluoro-phenyl)-thiazole-4-carboxylic acid ethyl ester, 95%, 2-(3-Fluoro-phenyl)-thiazole-4-carboxylic acid ethyl ester, 98%, 98%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg.
Ethyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate (CAS 132089-37-3) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: ethyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: XFUVBMWVICIKSW-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | ethyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | XFUVBMWVICIKSW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)