cas: 2304635-45-6 — see every product listed under this CAS number, including other names
Ethyl 2-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl)acetate 95% (CAS 2304635-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A622280-100mg |
| cas | 2304635-45-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 921.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A622280 |
Ethyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]acetate (CAS 2304635-45-6) is a chemical compound with the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. IUPAC name: ethyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]acetate. InChIKey: AAMVFZOJYQUKKP-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O4 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | ethyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]acetate |
| InChIKey | AAMVFZOJYQUKKP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)CC(=O)OCC |
Computed by PubChem (NCBI)