CAS 2096342-16-2 is the registry number for 2-(N-Methylaminomethyl)-5-nitrophenylboronic acid, pinacol ester, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-methyl-1-[4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (CAS 2096342-16-2) is a chemical compound with the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. IUPAC name: N-methyl-1-[4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine. InChIKey: RPKVATDWUMOWOI-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O4 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | N-methyl-1-[4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| InChIKey | RPKVATDWUMOWOI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])CNC |
Computed by PubChem (NCBI)