CAS 1150271-70-7 appears in our catalog under these names: 4-Ethylamino-3-nitrophenylboronic acid, pinacol ester, 96%, N-Ethyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 25g.
N-ethyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1150271-70-7) is a chemical compound with the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. IUPAC name: N-ethyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: BXMDNQXPKGCKNI-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O4 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | N-ethyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | BXMDNQXPKGCKNI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)