cas: 1620318-41-3 — see every product listed under this CAS number, including other names
Ethyl 2-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)acetate, 81%, 81% (CAS 1620318-41-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112SN5-100mg |
| cas | 1620318-41-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1024.40 Pln | |
| Chemat | 250mg | 1667.60 Pln | |
| Chemat | 500mg | 2738.00 Pln | |
| Chemat | 1g | 4077.20 Pln |
| purity | 81% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate (CAS 1620318-41-3) is a chemical compound with the molecular formula C14H21BO4S and a molecular weight of 296.2 g/mol. IUPAC name: ethyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate. InChIKey: QFDKZHPJLDBLKP-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | ethyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate |
| InChIKey | QFDKZHPJLDBLKP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CC(=O)OCC |
Computed by PubChem (NCBI)