CAS 1864802-09-4 appears in our catalog under these names: 3-(Methylsulfonylmethyl)phenylboronic acid pinacol ester, 95%, 3-(Methylsulfonylmethyl)phenylboronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(3-((methylsulfonyl)methyl)phenyl)-1,3,2-dioxaborolane 95%, 3-(Methylsulfonylmethyl)phenylboronic acid pinacol ester, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-[3-(methylsulfonylmethyl)phenyl]-1,3,2-dioxaborolane (CAS 1864802-09-4) is a chemical compound with the molecular formula C14H21BO4S and a molecular weight of 296.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-(methylsulfonylmethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: MCILNMLIKSDFJL-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-(methylsulfonylmethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | MCILNMLIKSDFJL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CS(=O)(=O)C |
Computed by PubChem (NCBI)