Products 2096331-73-4

CAS 2096331-73-4 is the registry number for 3-Ethylsulfonylphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(3-ethylsulfonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096331-73-4) is a chemical compound with the molecular formula C14H21BO4S and a molecular weight of 296.2 g/mol. IUPAC name: 2-(3-ethylsulfonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CBOADIUKJNYYPC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21BO4S
Molecular weight296.2 g/mol
IUPAC name2-(3-ethylsulfonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeyCBOADIUKJNYYPC-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)CC

Computed by PubChem (NCBI)