cas: 5100-57-2 — see every product listed under this CAS number, including other names
Ethyl 2-(quinolin-2-yl)acetate, 97%, 97% (CAS 5100-57-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBB6-100mg |
| cas | 5100-57-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1000.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-quinolin-2-ylacetate (CAS 5100-57-2) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: ethyl 2-quinolin-2-ylacetate. InChIKey: OQQYMAOGIWMABG-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | ethyl 2-quinolin-2-ylacetate |
| InChIKey | OQQYMAOGIWMABG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)