cas: 84186-23-2 — see every product listed under this CAS number, including other names
Ethyl 2-Cyano-3-(2-fluorophenyl)acrylate, 98%, 98% (CAS 84186-23-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q4V-100mg |
| cas | 84186-23-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 846.80 Pln | |
| Chemat | 5g | 2373.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (E)-2-cyano-3-(2-fluorophenyl)prop-2-enoate (CAS 84186-23-2) is a chemical compound with the molecular formula C12H10FNO2 and a molecular weight of 219.21 g/mol. IUPAC name: ethyl (E)-2-cyano-3-(2-fluorophenyl)prop-2-enoate. InChIKey: HAYFYQCUACVOEL-JXMROGBWSA-N.
| Molecular formula | C12H10FNO2 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-(2-fluorophenyl)prop-2-enoate |
| InChIKey | HAYFYQCUACVOEL-JXMROGBWSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=CC=C1F)/C#N |
Computed by PubChem (NCBI)