Ethyl 2-amino-5-(trifluoromethyl)thiophene-3-carboxylate, 95%
cas: 1481609-27-1 — see every product listed under this CAS number, including other names
Ethyl 2-amino-5-(trifluoromethyl)thiophene-3-carboxylate, 95% (CAS 1481609-27-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1069453-100mg |
| cas | 1481609-27-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1316.00 Pln | |
| Ambeed | 250mg | 2178.19 Pln | |
| Ambeed | 1g | 5738.19 Pln | |
| BLDpharm | 100mg | 1286.24 Pln | |
| BLDpharm | 250mg | 2135.94 Pln | |
| BLDpharm | 1g | 5629.15 Pln | |
| Chemat | 100mg | 784.40 Pln | |
| Chemat | 250mg | 1653.20 Pln | |
| Chemat | 1g | 5147.60 Pln | |
| Fluorochem | 100mg | 1455.76 Pln | |
| Fluorochem | 250mg | 3080.18 Pln | |
| Fluorochem | 1g | 9385.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 2-amino-5-(trifluoromethyl)thiophene-3-carboxylate (CAS 1481609-27-1) is a chemical compound with the molecular formula C8H8F3NO2S and a molecular weight of 239.22 g/mol. IUPAC name: ethyl 2-amino-5-(trifluoromethyl)thiophene-3-carboxylate. InChIKey: STAWMSHJYZKYJB-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO2S |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | ethyl 2-amino-5-(trifluoromethyl)thiophene-3-carboxylate |
| InChIKey | STAWMSHJYZKYJB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)