CAS 2007909-08-0 is the registry number for 2-(1,3-Dioxan-2-yl)-5-(trifluoromethyl)thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(1,3-dioxan-2-yl)-5-(trifluoromethyl)-1,3-thiazole (CAS 2007909-08-0) is a chemical compound with the molecular formula C8H8F3NO2S and a molecular weight of 239.22 g/mol. IUPAC name: 2-(1,3-dioxan-2-yl)-5-(trifluoromethyl)-1,3-thiazole. InChIKey: TUHWKFLJXRLRGC-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO2S |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 2-(1,3-dioxan-2-yl)-5-(trifluoromethyl)-1,3-thiazole |
| InChIKey | TUHWKFLJXRLRGC-UHFFFAOYSA-N |
| SMILES | C1COC(OC1)C2=NC=C(S2)C(F)(F)F |
Computed by PubChem (NCBI)