CAS 1516948-11-0 is the registry number for 3-(2,2,2-Trifluoro-ethanesulfonyl)-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2,2,2-trifluoroethylsulfonyl)aniline (CAS 1516948-11-0) is a chemical compound with the molecular formula C8H8F3NO2S and a molecular weight of 239.22 g/mol. IUPAC name: 3-(2,2,2-trifluoroethylsulfonyl)aniline. InChIKey: SCUILDVEYJICPL-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO2S |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethylsulfonyl)aniline |
| InChIKey | SCUILDVEYJICPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)CC(F)(F)F)N |
Computed by PubChem (NCBI)